C23H15ClFNO5S — CID 68543587
4-[2-[(2-chlorophenyl)methylsulfanyl]-3-(4-fluoro-3-nitrophenyl)prop-2-enoyl]benzoic acid (PubChem CID 68543587) has the molecular formula C23H15ClFNO5S and a molecular weight of 471.89 g/mol. Its IUPAC name is 4-[2-[(2-chlorophenyl)methylsulfanyl]-3-(4-fluoro-3-nitrophenyl)prop-2-enoyl]benzoic acid.
| Compound Name | 4-[2-[(2-chlorophenyl)methylsulfanyl]-3-(4-fluoro-3-nitrophenyl)prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 68543587 |
| Molecular Formula | C23H15ClFNO5S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 4-[2-[(2-chlorophenyl)methylsulfanyl]-3-(4-fluoro-3-nitrophenyl)prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)C(=Cc2ccc(F)c([N+](=O)[O-])c2)SCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H15ClFNO5S/c24-18-4-2-1-3-17(18)13-32-21(12-14-5-10-19(25)20(11-14)26(30)31)22(27)15-6-8-16(9-7-15)23(28)29/h1-12H,13H2,(H,28,29) |
| InChIKey | RJLHULXOUISPSV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|