C29H27F2N3O5S — CID 68539195
1-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-[4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]phenyl]prop-2-en-1-one (PubChem CID 68539195) has the molecular formula C29H27F2N3O5S and a molecular weight of 567.61 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-[4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-[4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68539195 |
| Molecular Formula | C29H27F2N3O5S |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-[4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]phenyl]prop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccc(C(=O)N2CCN(CCO)CC2)cc1)SCc1ccc(F)cc1)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27F2N3O5S/c30-24-8-3-21(4-9-24)19-40-27(28(36)23-7-10-25(31)26(18-23)34(38)39)17-20-1-5-22(6-2-20)29(37)33-13-11-32(12-14-33)15-16-35/h1-10,17-18,35H,11-16,19H2 |
| InChIKey | HXZSSKYWJPGQNO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|