C25H22Cl2O4S — CID 68539980
1-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 68539980) has the molecular formula C25H22Cl2O4S and a molecular weight of 489.42 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68539980 |
| Molecular Formula | C25H22Cl2O4S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=C(SCc2ccccc2Cl)C(=O)c2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C25H22Cl2O4S/c1-29-21-13-10-17(24(30-2)25(21)31-3)14-22(23(28)16-8-11-19(26)12-9-16)32-15-18-6-4-5-7-20(18)27/h4-14H,15H2,1-3H3 |
| InChIKey | YOKMWZINJHMQAU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|