C25H21Cl3O4S — CID 68541933
1-(4-chlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 68541933) has the molecular formula C25H21Cl3O4S and a molecular weight of 523.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68541933 |
| Molecular Formula | C25H21Cl3O4S |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C=C(SCc2ccc(Cl)c(Cl)c2)C(=O)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H21Cl3O4S/c1-30-18-11-22(31-2)19(23(12-18)32-3)13-24(25(29)16-5-7-17(26)8-6-16)33-14-15-4-9-20(27)21(28)10-15/h4-13H,14H2,1-3H3 |
| InChIKey | BVKAJDPEUWQQJF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|