C25H22BrNO7S — CID 24959281
(E)-2-[(4-bromophenyl)methylsulfanyl]-3-(4-hydroxy-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 24959281) has the molecular formula C25H22BrNO7S and a molecular weight of 560.42 g/mol. Its IUPAC name is (E)-2-[(4-bromophenyl)methylsulfanyl]-3-(4-hydroxy-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-2-[(4-bromophenyl)methylsulfanyl]-3-(4-hydroxy-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24959281 |
| Molecular Formula | C25H22BrNO7S |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | (E)-2-[(4-bromophenyl)methylsulfanyl]-3-(4-hydroxy-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C(=C\c2ccc(O)c([N+](=O)[O-])c2)SCc2ccc(Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22BrNO7S/c1-32-21-12-17(13-22(33-2)25(21)34-3)24(29)23(35-14-15-4-7-18(26)8-5-15)11-16-6-9-20(28)19(10-16)27(30)31/h4-13,28H,14H2,1-3H3/b23-11+ |
| InChIKey | HCXPFKKQVHXNDN-FOKLQQMPSA-N |
| XLogP | 6.25 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|