C21H13Br3O4S — CID 52949500
(E)-3-(4-bromo-3-hydroxyphenyl)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonylprop-2-en-1-one (PubChem CID 52949500) has the molecular formula C21H13Br3O4S and a molecular weight of 601.11 g/mol. Its IUPAC name is (E)-3-(4-bromo-3-hydroxyphenyl)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonylprop-2-en-1-one.
| Compound Name | (E)-3-(4-bromo-3-hydroxyphenyl)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonylprop-2-en-1-one |
|---|---|
| PubChem CID | 52949500 |
| Molecular Formula | C21H13Br3O4S |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 597.81 |
| IUPAC Name | (E)-3-(4-bromo-3-hydroxyphenyl)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonylprop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(Br)c(O)c1)S(=O)(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H13Br3O4S/c22-15-4-2-14(3-5-15)21(26)20(12-13-1-10-18(24)19(25)11-13)29(27,28)17-8-6-16(23)7-9-17/h1-12,25H/b20-12+ |
| InChIKey | KCJJLLWHRPTTDP-UDWIEESQSA-N |
| XLogP | 6.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|