C22H15BrCl2O2S — CID 68543469
1-(4-bromophenyl)-3-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)sulfanylprop-2-en-1-one (PubChem CID 68543469) has the molecular formula C22H15BrCl2O2S and a molecular weight of 494.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)sulfanylprop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)sulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 68543469 |
| Molecular Formula | C22H15BrCl2O2S |
| Molecular Weight | 494.24 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)sulfanylprop-2-en-1-one |
| SMILES | COc1ccc(SC(=Cc2ccc(Cl)cc2Cl)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H15BrCl2O2S/c1-27-18-8-10-19(11-9-18)28-21(12-15-4-7-17(24)13-20(15)25)22(26)14-2-5-16(23)6-3-14/h2-13H,1H3 |
| InChIKey | CNFCLGVKCFNREB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.24 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|