C20H18Cl2O4 — CID 118736219
[(E)-4-(2,4-dichlorophenyl)-3-(4-methoxybenzoyl)but-3-enyl] acetate (PubChem CID 118736219) has the molecular formula C20H18Cl2O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is [(E)-4-(2,4-dichlorophenyl)-3-(4-methoxybenzoyl)but-3-enyl] acetate.
| Compound Name | [(E)-4-(2,4-dichlorophenyl)-3-(4-methoxybenzoyl)but-3-enyl] acetate |
|---|---|
| PubChem CID | 118736219 |
| Molecular Formula | C20H18Cl2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [(E)-4-(2,4-dichlorophenyl)-3-(4-methoxybenzoyl)but-3-enyl] acetate |
| SMILES | COc1ccc(C(=O)/C(=C/c2ccc(Cl)cc2Cl)CCOC(C)=O)cc1 |
| InChI | InChI=1S/C20H18Cl2O4/c1-13(23)26-10-9-16(11-15-3-6-17(21)12-19(15)22)20(24)14-4-7-18(25-2)8-5-14/h3-8,11-12H,9-10H2,1-2H3/b16-11+ |
| InChIKey | AFQXZYSIGZKFJK-LFIBNONCSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|