C23H19Cl2NO — CID 142404394
(E)-2-[(benzylamino)methyl]-3-(2,4-dichlorophenyl)-1-phenylprop-2-en-1-one (PubChem CID 142404394) has the molecular formula C23H19Cl2NO and a molecular weight of 396.32 g/mol. Its IUPAC name is (E)-2-[(benzylamino)methyl]-3-(2,4-dichlorophenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-2-[(benzylamino)methyl]-3-(2,4-dichlorophenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 142404394 |
| Molecular Formula | C23H19Cl2NO |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (E)-2-[(benzylamino)methyl]-3-(2,4-dichlorophenyl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(Cl)cc1Cl)CNCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2NO/c24-21-12-11-19(22(25)14-21)13-20(23(27)18-9-5-2-6-10-18)16-26-15-17-7-3-1-4-8-17/h1-14,26H,15-16H2/b20-13+ |
| InChIKey | HFFJJJXCTMMPFS-DEDYPNTBSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|