C16H17Cl2NO2 — CID 23291615
2,4-dichlorobenzaldehyde;2-(4-methoxyphenyl)ethanamine (PubChem CID 23291615) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2,4-dichlorobenzaldehyde;2-(4-methoxyphenyl)ethanamine.
| Compound Name | 2,4-dichlorobenzaldehyde;2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 23291615 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2,4-dichlorobenzaldehyde;2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCN)cc1.O=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H13NO.C7H4Cl2O/c1-11-9-4-2-8(3-5-9)6-7-10;8-6-2-1-5(4-10)7(9)3-6/h2-5H,6-7,10H2,1H3;1-4H |
| InChIKey | APENKFSBRFLASW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|