C19H25NO3 — CID 23291631
2-(4-methoxyphenyl)ethanamine;4-propoxybenzaldehyde (PubChem CID 23291631) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethanamine;4-propoxybenzaldehyde.
| Compound Name | 2-(4-methoxyphenyl)ethanamine;4-propoxybenzaldehyde |
|---|---|
| PubChem CID | 23291631 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(4-methoxyphenyl)ethanamine;4-propoxybenzaldehyde |
| SMILES | CCCOc1ccc(C=O)cc1.COc1ccc(CCN)cc1 |
| InChI | InChI=1S/C10H12O2.C9H13NO/c1-2-7-12-10-5-3-9(8-11)4-6-10;1-11-9-4-2-8(3-5-9)6-7-10/h3-6,8H,2,7H2,1H3;2-5H,6-7,10H2,1H3 |
| InChIKey | ZNRZQMOWBGCWNY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|