C27H33NO4 — CID 23291704
4-butoxybenzaldehyde;2-phenylacetic acid;2-phenylethanamine (PubChem CID 23291704) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 4-butoxybenzaldehyde;2-phenylacetic acid;2-phenylethanamine.
| Compound Name | 4-butoxybenzaldehyde;2-phenylacetic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 23291704 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-butoxybenzaldehyde;2-phenylacetic acid;2-phenylethanamine |
| SMILES | CCCCOc1ccc(C=O)cc1.NCCc1ccccc1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H14O2.C8H11N.C8H8O2/c1-2-3-8-13-11-6-4-10(9-12)5-7-11;9-7-6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7/h4-7,9H,2-3,8H2,1H3;1-5H,6-7,9H2;1-5H,6H2,(H,9,10) |
| InChIKey | IAZWKDVNWPTRJJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|