C16H14ClNO3S — CID 68946157
2-[(4-chlorophenyl)methylsulfanyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 68946157) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 68946157 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | NC(=O)C(=Cc1ccc(O)c(O)c1)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO3S/c17-12-4-1-10(2-5-12)9-22-15(16(18)21)8-11-3-6-13(19)14(20)7-11/h1-8,19-20H,9H2,(H2,18,21) |
| InChIKey | FAPUBLZTGDFVLT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|