C10H12N2O3 — CID 78319178
(E)-2-(aminomethyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 78319178) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (E)-2-(aminomethyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-(aminomethyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78319178 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (E)-2-(aminomethyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | NC/C(=C\c1ccc(O)c(O)c1)C(N)=O |
| InChI | InChI=1S/C10H12N2O3/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,13-14H,5,11H2,(H2,12,15)/b7-3+ |
| InChIKey | JCMQLNXAKGIOEP-XVNBXDOJSA-N |
| XLogP | -0.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|