C10H10N2O4 — CID 3422644
2-[(3,4-dihydroxyphenyl)methylidene]propanediamide (PubChem CID 3422644) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylidene]propanediamide.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 3422644 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylidene]propanediamide |
| SMILES | NC(=O)C(=Cc1ccc(O)c(O)c1)C(N)=O |
| InChI | InChI=1S/C10H10N2O4/c11-9(15)6(10(12)16)3-5-1-2-7(13)8(14)4-5/h1-4,13-14H,(H2,11,15)(H2,12,16) |
| InChIKey | FPPRLDMIVZBERU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|