C16H16N2O6S — CID 68946939
(E)-3-(3,4-dihydroxyphenyl)-2-[(4-methoxyphenyl)sulfamoyl]prop-2-enamide (PubChem CID 68946939) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-2-[(4-methoxyphenyl)sulfamoyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-2-[(4-methoxyphenyl)sulfamoyl]prop-2-enamide |
|---|---|
| PubChem CID | 68946939 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-2-[(4-methoxyphenyl)sulfamoyl]prop-2-enamide |
| SMILES | COc1ccc(NS(=O)(=O)/C(=C/c2ccc(O)c(O)c2)C(N)=O)cc1 |
| InChI | InChI=1S/C16H16N2O6S/c1-24-12-5-3-11(4-6-12)18-25(22,23)15(16(17)21)9-10-2-7-13(19)14(20)8-10/h2-9,18-20H,1H3,(H2,17,21)/b15-9+ |
| InChIKey | QIJRJTHNDNDIQR-OQLLNIDSSA-N |
| XLogP | 1.37 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|