About 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde
3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde (PubChem CID 158431021) has the molecular formula C14H12O6
and a molecular weight of 278.26 g/mol. Its IUPAC name is 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde |
| PubChem CID | 158431021 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)c(O)c1.[2H]Oc1ccc(C=O)cc1O[2H] |
| InChI | InChI=1S/2C7H6O3/c2*8-4-5-1-2-6(9)7(10)3-5/h2*1-4,9-10H/i/hD2 |
| InChIKey | HBQRAUJPLJWVDR-ZSJDYOACSA-N |
| XLogP | 1.82 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde?
The IUPAC name of 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde (CID 158431021) is 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde.
What is the SMILES notation for 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde?
The canonical SMILES for 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde is O=Cc1ccc(O)c(O)c1.[2H]Oc1ccc(C=O)cc1O[2H].
What is the InChIKey of 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde?
The InChIKey is HBQRAUJPLJWVDR-ZSJDYOACSA-N. The full InChI is InChI=1S/2C7H6O3/c2*8-4-5-1-2-6(9)7(10)3-5/h2*1-4,9-10H/i/hD2.
What are the key properties of 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde?
3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde has a molecular weight of 278.26 g/mol, XLogP of 1.82, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dideuteriooxybenzaldehyde;3,4-dihydroxybenzaldehyde is sourced from PubChem (CID 158431021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).