C8H13N5O3 — CID 174188033
diaziridine-1,3,3-triamine;3,4-dihydroxybenzaldehyde (PubChem CID 174188033) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is diaziridine-1,3,3-triamine;3,4-dihydroxybenzaldehyde.
| Compound Name | diaziridine-1,3,3-triamine;3,4-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 174188033 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | diaziridine-1,3,3-triamine;3,4-dihydroxybenzaldehyde |
| SMILES | NN1NC1(N)N.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H6O3.CH7N5/c8-4-5-1-2-6(9)7(10)3-5;2-1(3)5-6(1)4/h1-4,9-10H;5H,2-4H2 |
| InChIKey | WGSCQNYWPFTXJP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 160.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|