C19H18O5 — CID 67804979
1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-dien-4-one (PubChem CID 67804979) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-dien-4-one.
| Compound Name | 1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 67804979 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-dien-4-one |
| SMILES | O=C(CC=Cc1ccc(O)c(O)c1)CC=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H18O5/c20-15(5-1-3-13-7-9-16(21)18(23)11-13)6-2-4-14-8-10-17(22)19(24)12-14/h1-4,7-12,21-24H,5-6H2 |
| InChIKey | HBPUKNLAXYTHQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|