C16H9F6NOS — CID 91307863
2-[(4-fluorophenyl)methylsulfanyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 91307863) has the molecular formula C16H9F6NOS and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91307863 |
| Molecular Formula | C16H9F6NOS |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | NC(=O)C(=Cc1c(F)c(F)c(F)c(F)c1F)SCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H9F6NOS/c17-8-3-1-7(2-4-8)6-25-10(16(23)24)5-9-11(18)13(20)15(22)14(21)12(9)19/h1-5H,6H2,(H2,23,24) |
| InChIKey | YVXZPWTVRKJFPA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|