C24H26N4OS2 — CID 11850628
4-[4,6-bis(benzylsulfanyl)-3-methylpyrazolo[5,4-d]pyrimidin-1-yl]butan-1-ol (PubChem CID 11850628) has the molecular formula C24H26N4OS2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-[4,6-bis(benzylsulfanyl)-3-methylpyrazolo[5,4-d]pyrimidin-1-yl]butan-1-ol.
| Compound Name | 4-[4,6-bis(benzylsulfanyl)-3-methylpyrazolo[5,4-d]pyrimidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 11850628 |
| Molecular Formula | C24H26N4OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[4,6-bis(benzylsulfanyl)-3-methylpyrazolo[5,4-d]pyrimidin-1-yl]butan-1-ol |
| SMILES | Cc1nn(CCCCO)c2nc(SCc3ccccc3)nc(SCc3ccccc3)c12 |
| InChI | InChI=1S/C24H26N4OS2/c1-18-21-22(28(27-18)14-8-9-15-29)25-24(31-17-20-12-6-3-7-13-20)26-23(21)30-16-19-10-4-2-5-11-19/h2-7,10-13,29H,8-9,14-17H2,1H3 |
| InChIKey | WYMRPHRQUFWYFB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|