C14H14N4OS — CID 16729532
2-(4-benzylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethanol (PubChem CID 16729532) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-(4-benzylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethanol.
| Compound Name | 2-(4-benzylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethanol |
|---|---|
| PubChem CID | 16729532 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(4-benzylsulfanylpyrazolo[5,4-d]pyrimidin-1-yl)ethanol |
| SMILES | OCCn1ncc2c(SCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C14H14N4OS/c19-7-6-18-13-12(8-17-18)14(16-10-15-13)20-9-11-4-2-1-3-5-11/h1-5,8,10,19H,6-7,9H2 |
| InChIKey | VTEJVJSZESCEMN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |