C13H11N5O — CID 135822639
2-amino-7-benzyl-3H-pteridin-4-one (PubChem CID 135822639) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-amino-7-benzyl-3H-pteridin-4-one.
| Compound Name | 2-amino-7-benzyl-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135822639 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-amino-7-benzyl-3H-pteridin-4-one |
| SMILES | Nc1nc2nc(Cc3ccccc3)cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H11N5O/c14-13-17-11-10(12(19)18-13)15-7-9(16-11)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H3,14,16,17,18,19) |
| InChIKey | YSTLGGKZMZZCDF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |