C13H10N4OS — CID 163721374
6-benzyl-2-sulfanylidene-1H-pteridin-4-one (PubChem CID 163721374) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 6-benzyl-2-sulfanylidene-1H-pteridin-4-one.
| Compound Name | 6-benzyl-2-sulfanylidene-1H-pteridin-4-one |
|---|---|
| PubChem CID | 163721374 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 6-benzyl-2-sulfanylidene-1H-pteridin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2ncc(Cc3ccccc3)nc12 |
| InChI | InChI=1S/C13H10N4OS/c18-12-10-11(16-13(19)17-12)14-7-9(15-10)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,14,16,17,18,19) |
| InChIKey | KRXBQDKJNOXSCV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|