C15H13N3O — CID 132584777
2-benzyl-7-methyl-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 132584777) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-benzyl-7-methyl-4H-pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 2-benzyl-7-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 132584777 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-benzyl-7-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | Cc1cnc2[nH]c(=O)c(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C15H13N3O/c1-10-7-12-14(16-9-10)18-15(19)13(17-12)8-11-5-3-2-4-6-11/h2-7,9H,8H2,1H3,(H,16,18,19) |
| InChIKey | WFINKZTWAQECCN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |