C30H28N4O4 — CID 160851609
benzene-1,2-diamine;3-benzyl-1H-quinoxalin-2-one;2-oxo-3-phenylpropanoic acid (PubChem CID 160851609) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is benzene-1,2-diamine;3-benzyl-1H-quinoxalin-2-one;2-oxo-3-phenylpropanoic acid.
| Compound Name | benzene-1,2-diamine;3-benzyl-1H-quinoxalin-2-one;2-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 160851609 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | benzene-1,2-diamine;3-benzyl-1H-quinoxalin-2-one;2-oxo-3-phenylpropanoic acid |
| SMILES | Nc1ccccc1N.O=C(O)C(=O)Cc1ccccc1.O=c1[nH]c2ccccc2nc1Cc1ccccc1 |
| InChI | InChI=1S/C15H12N2O.C9H8O3.C6H8N2/c18-15-14(10-11-6-2-1-3-7-11)16-12-8-4-5-9-13(12)17-15;10-8(9(11)12)6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)8/h1-9H,10H2,(H,17,18);1-5H,6H2,(H,11,12);1-4H,7-8H2 |
| InChIKey | SJIGCZKOMCLBLM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|