C14H10N2O3 — CID 121209654
3-[2-(furan-2-yl)-2-oxoethyl]-1H-quinoxalin-2-one (PubChem CID 121209654) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-oxoethyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[2-(furan-2-yl)-2-oxoethyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 121209654 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-oxoethyl]-1H-quinoxalin-2-one |
| SMILES | O=C(Cc1nc2ccccc2[nH]c1=O)c1ccco1 |
| InChI | InChI=1S/C14H10N2O3/c17-12(13-6-3-7-19-13)8-11-14(18)16-10-5-2-1-4-9(10)15-11/h1-7H,8H2,(H,16,18) |
| InChIKey | XFRKAGFOYSTTCM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |