C14H9N3O2 — CID 6928339
(2R)-2-(1H-benzimidazol-2-yl)-3-(furan-2-yl)-3-oxopropanenitrile (PubChem CID 6928339) has the molecular formula C14H9N3O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is (2R)-2-(1H-benzimidazol-2-yl)-3-(furan-2-yl)-3-oxopropanenitrile.
| Compound Name | (2R)-2-(1H-benzimidazol-2-yl)-3-(furan-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 6928339 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (2R)-2-(1H-benzimidazol-2-yl)-3-(furan-2-yl)-3-oxopropanenitrile |
| SMILES | N#C[C@@H](C(=O)c1ccco1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H9N3O2/c15-8-9(13(18)12-6-3-7-19-12)14-16-10-4-1-2-5-11(10)17-14/h1-7,9H,(H,16,17)/t9-/m0/s1 |
| InChIKey | DREOBWVEOKBSMQ-VIFPVBQESA-N |
| XLogP | 2.65 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |