C20H18N2O4 — CID 1300937
(4-acetylphenyl)methyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate (PubChem CID 1300937) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (4-acetylphenyl)methyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate.
| Compound Name | (4-acetylphenyl)methyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate |
|---|---|
| PubChem CID | 1300937 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (4-acetylphenyl)methyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate |
| SMILES | CC(=O)c1ccc(COC(=O)CCc2nc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-13(23)15-8-6-14(7-9-15)12-26-19(24)11-10-18-20(25)22-17-5-3-2-4-16(17)21-18/h2-9H,10-12H2,1H3,(H,22,25) |
| InChIKey | ZMFXGUGEGNBMOQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |