C19H15N3O3S — CID 2408084
1,3-benzothiazol-2-ylmethyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate (PubChem CID 2408084) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate |
|---|---|
| PubChem CID | 2408084 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-(3-oxo-4H-quinoxalin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N3O3S/c23-18(25-11-17-21-14-7-3-4-8-16(14)26-17)10-9-15-19(24)22-13-6-2-1-5-12(13)20-15/h1-8H,9-11H2,(H,22,24) |
| InChIKey | VJJPHDKWKUSBHQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |