C25H20N2O5 — CID 1300594
phenyl 3-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyloxymethyl]benzoate (PubChem CID 1300594) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is phenyl 3-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyloxymethyl]benzoate.
| Compound Name | phenyl 3-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 1300594 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | phenyl 3-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyloxymethyl]benzoate |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)OCc1cccc(C(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H20N2O5/c28-23(14-13-22-24(29)27-21-12-5-4-11-20(21)26-22)31-16-17-7-6-8-18(15-17)25(30)32-19-9-2-1-3-10-19/h1-12,15H,13-14,16H2,(H,27,29) |
| InChIKey | TUGUEEFSAJKFRE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|