C22H16N4OS — CID 139016580
6,7-bis[(E)-2-phenylethenyl]-2-sulfanylidene-1H-pteridin-4-one (PubChem CID 139016580) has the molecular formula C22H16N4OS and a molecular weight of 384.46 g/mol. Its IUPAC name is 6,7-bis[(E)-2-phenylethenyl]-2-sulfanylidene-1H-pteridin-4-one.
| Compound Name | 6,7-bis[(E)-2-phenylethenyl]-2-sulfanylidene-1H-pteridin-4-one |
|---|---|
| PubChem CID | 139016580 |
| Molecular Formula | C22H16N4OS |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 6,7-bis[(E)-2-phenylethenyl]-2-sulfanylidene-1H-pteridin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc(/C=C/c3ccccc3)c(/C=C/c3ccccc3)nc12 |
| InChI | InChI=1S/C22H16N4OS/c27-21-19-20(25-22(28)26-21)24-18(14-12-16-9-5-2-6-10-16)17(23-19)13-11-15-7-3-1-4-8-15/h1-14H,(H2,24,25,26,27,28)/b13-11+,14-12+ |
| InChIKey | NXEZUXWQCHKUBS-PHEQNACWSA-N |
| XLogP | 4.72 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|