C15H14N4O — CID 136679439
2-amino-6-(2-phenylethyl)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 136679439) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-amino-6-(2-phenylethyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-(2-phenylethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136679439 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-amino-6-(2-phenylethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2ncc(CCc3ccccc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H14N4O/c16-15-18-13-12(14(20)19-15)8-11(9-17-13)7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H3,16,17,18,19,20) |
| InChIKey | LFERZTJYFIUZJC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |