C15H12N4O — CID 135513803
15-amino-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one (PubChem CID 135513803) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 15-amino-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one.
| Compound Name | 15-amino-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one |
|---|---|
| PubChem CID | 135513803 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 15-amino-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one |
| SMILES | Nc1nc2nc3c(cc2c(=O)[nH]1)CCc1ccccc1-3 |
| InChI | InChI=1S/C15H12N4O/c16-15-18-13-11(14(20)19-15)7-9-6-5-8-3-1-2-4-10(8)12(9)17-13/h1-4,7H,5-6H2,(H3,16,17,18,19,20) |
| InChIKey | BECDIWBGYRERAY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |