C15H11N3OS — CID 10755271
15-sulfanylidene-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaen-13-one (PubChem CID 10755271) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 15-sulfanylidene-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaen-13-one.
| Compound Name | 15-sulfanylidene-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaen-13-one |
|---|---|
| PubChem CID | 10755271 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 15-sulfanylidene-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaen-13-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc3c(cc12)CCc1ccccc1-3 |
| InChI | InChI=1S/C15H11N3OS/c19-14-11-7-9-6-5-8-3-1-2-4-10(8)12(9)16-13(11)17-15(20)18-14/h1-4,7H,5-6H2,(H2,16,17,18,19,20) |
| InChIKey | UADLCHUZMMQROK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|