C17H15N3OS — CID 10614846
14-methyl-15-methylsulfanyl-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one (PubChem CID 10614846) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 14-methyl-15-methylsulfanyl-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one.
| Compound Name | 14-methyl-15-methylsulfanyl-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one |
|---|---|
| PubChem CID | 10614846 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 14-methyl-15-methylsulfanyl-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17),15-heptaen-13-one |
| SMILES | CSc1nc2nc3c(cc2c(=O)n1C)CCc1ccccc1-3 |
| InChI | InChI=1S/C17H15N3OS/c1-20-16(21)13-9-11-8-7-10-5-3-4-6-12(10)14(11)18-15(13)19-17(20)22-2/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | CBXHLKLRINZZEY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |