C15H14ClN5 — CID 134093989
14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-13,15-diamine;hydrochloride (PubChem CID 134093989) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is 14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-13,15-diamine;hydrochloride.
| Compound Name | 14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-13,15-diamine;hydrochloride |
|---|---|
| PubChem CID | 134093989 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-13,15-diamine;hydrochloride |
| SMILES | Cl.Nc1nc(N)c2cc3c(nc2n1)-c1ccccc1CC3 |
| InChI | InChI=1S/C15H13N5.ClH/c16-13-11-7-9-6-5-8-3-1-2-4-10(8)12(9)18-14(11)20-15(17)19-13;/h1-4,7H,5-6H2,(H4,16,17,18,19,20);1H |
| InChIKey | MBGABWRVHHSDEK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |