C15H17N3 — CID 142710262
3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-4-amine (PubChem CID 142710262) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-4-amine.
| Compound Name | 3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-4-amine |
|---|---|
| PubChem CID | 142710262 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-4-amine |
| SMILES | Nc1ncc2c(n1)-c1ccccc1CCCCC2 |
| InChI | InChI=1S/C15H17N3/c16-15-17-10-12-8-3-1-2-6-11-7-4-5-9-13(11)14(12)18-15/h4-5,7,9-10H,1-3,6,8H2,(H2,16,17,18) |
| InChIKey | PKBZRFFUUGRGEA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |