C19H25N5 — CID 67301773
6-[(3S)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-amine (PubChem CID 67301773) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-[(3S)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-amine.
| Compound Name | 6-[(3S)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-amine |
|---|---|
| PubChem CID | 67301773 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 6-[(3S)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-4-amine |
| SMILES | Nc1nc2c(c(N3CC[C@H](N)C3)n1)CCCCCc1ccccc1-2 |
| InChI | InChI=1S/C19H25N5/c20-14-10-11-24(12-14)18-16-9-3-1-2-6-13-7-4-5-8-15(13)17(16)22-19(21)23-18/h4-5,7-8,14H,1-3,6,9-12,20H2,(H2,21,22,23)/t14-/m0/s1 |
| InChIKey | DSWMQMFPTLMZCE-AWEZNQCLSA-N |
| XLogP | 2.53 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |