C19H25N5 — CID 25074119
6-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine (PubChem CID 25074119) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine.
| Compound Name | 6-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 25074119 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 6-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
| SMILES | CN(C)[C@@H]1CCN(c2nc(N)nc3c2CCCc2ccccc2-3)C1 |
| InChI | InChI=1S/C19H25N5/c1-23(2)14-10-11-24(12-14)18-16-9-5-7-13-6-3-4-8-15(13)17(16)21-19(20)22-18/h3-4,6,8,14H,5,7,9-12H2,1-2H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | DLXAROJSPSRLLS-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |