C19H23N5 — CID 66741343
6-(2,6-diazabicyclo[3.2.1]octan-2-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine (PubChem CID 66741343) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-(2,6-diazabicyclo[3.2.1]octan-2-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine.
| Compound Name | 6-(2,6-diazabicyclo[3.2.1]octan-2-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 66741343 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 6-(2,6-diazabicyclo[3.2.1]octan-2-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
| SMILES | Nc1nc2c(c(N3CCC4CC3CN4)n1)CCCc1ccccc1-2 |
| InChI | InChI=1S/C19H23N5/c20-19-22-17-15-6-2-1-4-12(15)5-3-7-16(17)18(23-19)24-9-8-13-10-14(24)11-21-13/h1-2,4,6,13-14,21H,3,5,7-11H2,(H2,20,22,23) |
| InChIKey | XXCCZGLLQHHZPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |