C18H21N5 — CID 67302601
6-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine (PubChem CID 67302601) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 6-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine.
| Compound Name | 6-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 67302601 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-4-amine |
| SMILES | Nc1nc2c(c(N3CC4CNCC43)n1)CCCc1ccccc1-2 |
| InChI | InChI=1S/C18H21N5/c19-18-21-16-13-6-2-1-4-11(13)5-3-7-14(16)17(22-18)23-10-12-8-20-9-15(12)23/h1-2,4,6,12,15,20H,3,5,7-10H2,(H2,19,21,22) |
| InChIKey | RKURRDGLLNBWQJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |