C18H23N5 — CID 67302144
6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-4-amine (PubChem CID 67302144) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-4-amine.
| Compound Name | 6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-4-amine |
|---|---|
| PubChem CID | 67302144 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 6-[(3R)-3-aminopyrrolidin-1-yl]-3,5-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-4-amine |
| SMILES | Nc1nc2c(c(N3CC[C@@H](N)C3)n1)CCCCc1ccccc1-2 |
| InChI | InChI=1S/C18H23N5/c19-13-9-10-23(11-13)17-15-8-4-2-6-12-5-1-3-7-14(12)16(15)21-18(20)22-17/h1,3,5,7,13H,2,4,6,8-11,19H2,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | XHRRQXOMZGMLSK-CYBMUJFWSA-N |
| XLogP | 2.14 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |