C16H21N5S — CID 44513554
11-[(3R)-3-(methylamino)pyrrolidin-1-yl]-5-thia-12,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-13-amine (PubChem CID 44513554) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 11-[(3R)-3-(methylamino)pyrrolidin-1-yl]-5-thia-12,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-13-amine.
| Compound Name | 11-[(3R)-3-(methylamino)pyrrolidin-1-yl]-5-thia-12,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-13-amine |
|---|---|
| PubChem CID | 44513554 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 11-[(3R)-3-(methylamino)pyrrolidin-1-yl]-5-thia-12,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-13-amine |
| SMILES | CN[C@@H]1CCN(c2nc(N)nc3c2CCCc2sccc2-3)C1 |
| InChI | InChI=1S/C16H21N5S/c1-18-10-5-7-21(9-10)15-12-3-2-4-13-11(6-8-22-13)14(12)19-16(17)20-15/h6,8,10,18H,2-5,7,9H2,1H3,(H2,17,19,20)/t10-/m1/s1 |
| InChIKey | WUFMOIRADJGBDK-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |