C20H27N5 — CID 59774245
6-N-[(4-aminocyclohexyl)methyl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine (PubChem CID 59774245) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-N-[(4-aminocyclohexyl)methyl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine.
| Compound Name | 6-N-[(4-aminocyclohexyl)methyl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
|---|---|
| PubChem CID | 59774245 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 6-N-[(4-aminocyclohexyl)methyl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
| SMILES | Nc1nc(NCC2CCC(N)CC2)c2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C20H27N5/c21-15-10-8-13(9-11-15)12-23-19-17-7-3-5-14-4-1-2-6-16(14)18(17)24-20(22)25-19/h1-2,4,6,13,15H,3,5,7-12,21H2,(H3,22,23,24,25) |
| InChIKey | LKVFLDJAWASMRR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |