C20H27N5 — CID 59774314
6-N-(3-pyrrolidin-2-ylpropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine (PubChem CID 59774314) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-N-(3-pyrrolidin-2-ylpropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine.
| Compound Name | 6-N-(3-pyrrolidin-2-ylpropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
|---|---|
| PubChem CID | 59774314 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 6-N-(3-pyrrolidin-2-ylpropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
| SMILES | Nc1nc(NCCCC2CCCN2)c2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C20H27N5/c21-20-24-18-16-10-2-1-6-14(16)7-3-11-17(18)19(25-20)23-13-5-9-15-8-4-12-22-15/h1-2,6,10,15,22H,3-5,7-9,11-13H2,(H3,21,23,24,25) |
| InChIKey | XJRNBGORTCVLOG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|