C18H27N3 — CID 159745958
ethane;4-methyl-5,6-dihydrobenzo[h]quinazolin-2-amine;propane (PubChem CID 159745958) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is ethane;4-methyl-5,6-dihydrobenzo[h]quinazolin-2-amine;propane.
| Compound Name | ethane;4-methyl-5,6-dihydrobenzo[h]quinazolin-2-amine;propane |
|---|---|
| PubChem CID | 159745958 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | ethane;4-methyl-5,6-dihydrobenzo[h]quinazolin-2-amine;propane |
| SMILES | CC.CCC.Cc1nc(N)nc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C13H13N3.C3H8.C2H6/c1-8-10-7-6-9-4-2-3-5-11(9)12(10)16-13(14)15-8;1-3-2;1-2/h2-5H,6-7H2,1H3,(H2,14,15,16);3H2,1-2H3;1-2H3 |
| InChIKey | NDAWRLMHWYMUSL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |