C11H10N2O — CID 170794640
4,5-dihydrobenzo[e][1,3]benzoxazol-2-amine (PubChem CID 170794640) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 4,5-dihydrobenzo[e][1,3]benzoxazol-2-amine.
| Compound Name | 4,5-dihydrobenzo[e][1,3]benzoxazol-2-amine |
|---|---|
| PubChem CID | 170794640 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4,5-dihydrobenzo[e][1,3]benzoxazol-2-amine |
| SMILES | Nc1nc2c(o1)CCc1ccccc1-2 |
| InChI | InChI=1S/C11H10N2O/c12-11-13-10-8-4-2-1-3-7(8)5-6-9(10)14-11/h1-4H,5-6H2,(H2,12,13) |
| InChIKey | GQBLJRKSECTQGD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |