C10H12N4OS — CID 822190
3,6,7-trimethyl-2-methylsulfanylpteridin-4-one (PubChem CID 822190) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 3,6,7-trimethyl-2-methylsulfanylpteridin-4-one.
| Compound Name | 3,6,7-trimethyl-2-methylsulfanylpteridin-4-one |
|---|---|
| PubChem CID | 822190 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3,6,7-trimethyl-2-methylsulfanylpteridin-4-one |
| SMILES | CSc1nc2nc(C)c(C)nc2c(=O)n1C |
| InChI | InChI=1S/C10H12N4OS/c1-5-6(2)12-8-7(11-5)9(15)14(3)10(13-8)16-4/h1-4H3 |
| InChIKey | BIQMYFLCQYURON-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |