C9H11N5O — CID 130016632
2-amino-1,6,7-trimethylpteridin-4-one (PubChem CID 130016632) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-1,6,7-trimethylpteridin-4-one.
| Compound Name | 2-amino-1,6,7-trimethylpteridin-4-one |
|---|---|
| PubChem CID | 130016632 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-amino-1,6,7-trimethylpteridin-4-one |
| SMILES | Cc1nc2c(=O)nc(N)n(C)c2nc1C |
| InChI | InChI=1S/C9H11N5O/c1-4-5(2)12-7-6(11-4)8(15)13-9(10)14(7)3/h1-3H3,(H2,10,13,15) |
| InChIKey | WMLDYQYSJOTRJB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |